C9H18O3 — CID 59932067
(3S)-4,5-dimethoxy-2,3-dimethyloxane (PubChem CID 59932067) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (3S)-4,5-dimethoxy-2,3-dimethyloxane.
| Compound Name | (3S)-4,5-dimethoxy-2,3-dimethyloxane |
|---|---|
| PubChem CID | 59932067 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (3S)-4,5-dimethoxy-2,3-dimethyloxane |
| SMILES | COC1COC(C)[C@H](C)C1OC |
| InChI | InChI=1S/C9H18O3/c1-6-7(2)12-5-8(10-3)9(6)11-4/h6-9H,5H2,1-4H3/t6-,7?,8?,9?/m0/s1 |
| InChIKey | GETIIIJPXGVRGH-JUGFDQIVSA-N |
| XLogP | 1.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |