C60H52O9 — CID 176610555
[3,5-di(propan-2-yl)phenyl] 6-[3,5-bis(6-propan-2-yloxycarbonylnaphthalene-2-carbonyl)benzoyl]naphthalene-2-carboxylate (PubChem CID 176610555) has the molecular formula C60H52O9 and a molecular weight of 917.07 g/mol. Its IUPAC name is [3,5-di(propan-2-yl)phenyl] 6-[3,5-bis(6-propan-2-yloxycarbonylnaphthalene-2-carbonyl)benzoyl]naphthalene-2-carboxylate.
| Compound Name | [3,5-di(propan-2-yl)phenyl] 6-[3,5-bis(6-propan-2-yloxycarbonylnaphthalene-2-carbonyl)benzoyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 176610555 |
| Molecular Formula | C60H52O9 |
| Molecular Weight | 917.07 g/mol |
| Exact Mass | 916.36 |
| IUPAC Name | [3,5-di(propan-2-yl)phenyl] 6-[3,5-bis(6-propan-2-yloxycarbonylnaphthalene-2-carbonyl)benzoyl]naphthalene-2-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc2cc(C(=O)c3cc(C(=O)c4ccc5cc(C(=O)Oc6cc(C(C)C)cc(C(C)C)c6)ccc5c4)cc(C(=O)c4ccc5cc(C(=O)OC(C)C)ccc5c4)c3)ccc2c1 |
| InChI | InChI=1S/C60H52O9/c1-33(2)49-27-50(34(3)4)32-54(31-49)69-60(66)48-20-14-39-23-45(17-11-42(39)26-48)57(63)53-29-51(55(61)43-15-9-40-24-46(18-12-37(40)21-43)58(64)67-35(5)6)28-52(30-53)56(62)44-16-10-41-25-47(19-13-38(41)22-44)59(65)68-36(7)8/h9-36H,1-8H3 |
| InChIKey | KVJMOFKEOOWKHE-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.07 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|