C19H31FN6O14P2S — CID 176612784
[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(dimethylamino)-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate (PubChem CID 176612784) has the molecular formula C19H31FN6O14P2S and a molecular weight of 680.50 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(dimethylamino)-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(dimethylamino)-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 176612784 |
| Molecular Formula | C19H31FN6O14P2S |
| Molecular Weight | 680.50 g/mol |
| Exact Mass | 680.11 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(dimethylamino)-2-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
| SMILES | CN(C)[C@H]1[C@H](n2cnc3c(N)ncnc32)O[C@](F)(COP(O)(=S)OP(=O)(O)OC2OC([C@@H](O)CO)C(O)C(O)C2O)[C@H]1O |
| InChI | InChI=1S/C19H31FN6O14P2S/c1-25(2)9-14(32)19(20,38-17(9)26-6-24-8-15(21)22-5-23-16(8)26)4-36-42(35,43)40-41(33,34)39-18-12(31)10(29)11(30)13(37-18)7(28)3-27/h5-7,9-14,17-18,27-32H,3-4H2,1-2H3,(H,33,34)(H,35,43)(H2,21,22,23)/t7-,9+,10?,11?,12?,13?,14-,17+,18?,19+,42?/m0/s1 |
| InChIKey | IJELWEJKUAGQNF-LUPWVEDSSA-N |
| XLogP | -3.58 |
| TPSA | 297.92 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.50 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|