C18H29FN6O13P2S — CID 176613069
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(methylamino)oxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate (PubChem CID 176613069) has the molecular formula C18H29FN6O13P2S and a molecular weight of 650.47 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(methylamino)oxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(methylamino)oxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 176613069 |
| Molecular Formula | C18H29FN6O13P2S |
| Molecular Weight | 650.47 g/mol |
| Exact Mass | 650.10 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-(methylamino)oxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
| SMILES | CN[C@@H]1[C@H](O)[C@@H](COP(O)(=S)OP(=O)(O)OC2OC([C@@H](F)CO)C(O)C(O)C2O)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H29FN6O13P2S/c1-21-8-10(27)7(35-17(8)25-5-24-9-15(20)22-4-23-16(9)25)3-34-40(33,41)38-39(31,32)37-18-13(30)11(28)12(29)14(36-18)6(19)2-26/h4-8,10-14,17-18,21,26-30H,2-3H2,1H3,(H,31,32)(H,33,41)(H2,20,22,23)/t6-,7+,8+,10+,11?,12?,13?,14?,17+,18?,40?/m0/s1 |
| InChIKey | LOYMJJSDPGYZCQ-UJNCIDASSA-N |
| XLogP | -3.24 |
| TPSA | 286.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.47 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|