C21H33FN6O13P2S — CID 167120639
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(azetidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate (PubChem CID 167120639) has the molecular formula C21H33FN6O13P2S and a molecular weight of 690.54 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(azetidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(azetidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 167120639 |
| Molecular Formula | C21H33FN6O13P2S |
| Molecular Weight | 690.54 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-(azetidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(O)(=S)OP(=O)(O)OC2OCC([C@@H](F)CO)C(O)C(O)C2O)[C@@H](O)[C@H]1N1CCC1 |
| InChI | InChI=1S/C21H33FN6O13P2S/c22-10(4-29)9-5-37-21(17(33)16(32)14(9)30)40-42(34,35)41-43(36,44)38-6-11-15(31)13(27-2-1-3-27)20(39-11)28-8-26-12-18(23)24-7-25-19(12)28/h7-11,13-17,20-21,29-33H,1-6H2,(H,34,35)(H,36,44)(H2,23,24,25)/t9?,10-,11+,13+,14?,15+,16?,17?,20+,21?,43?/m0/s1 |
| InChIKey | WAILLRBPAGSTDG-MYWFPJGYSA-N |
| XLogP | -2.51 |
| TPSA | 277.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.54 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|