C18H29N5O14P2S — CID 167121138
[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate (PubChem CID 167121138) has the molecular formula C18H29N5O14P2S and a molecular weight of 633.47 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 167121138 |
| Molecular Formula | C18H29N5O14P2S |
| Molecular Weight | 633.47 g/mol |
| Exact Mass | 633.09 |
| IUPAC Name | [[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(O)(=S)OP(=O)(O)OC2OCC([C@@H](O)CO)C(O)C(O)C2O)O1 |
| InChI | InChI=1S/C18H29N5O14P2S/c19-16-12-17(21-5-20-16)23(6-22-12)11-1-8(25)10(35-11)4-34-39(32,40)37-38(30,31)36-18-15(29)14(28)13(27)7(3-33-18)9(26)2-24/h5-11,13-15,18,24-29H,1-4H2,(H,30,31)(H,32,40)(H2,19,20,21)/t7?,8-,9-,10+,11+,13?,14?,15?,18?,39?/m0/s1 |
| InChIKey | WPOYLJYKLDVDED-LXFHCNMGSA-N |
| XLogP | -3.17 |
| TPSA | 294.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.47 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|