C18H28FN5O14P2S — CID 167121137
[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate (PubChem CID 167121137) has the molecular formula C18H28FN5O14P2S and a molecular weight of 651.46 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 167121137 |
| Molecular Formula | C18H28FN5O14P2S |
| Molecular Weight | 651.46 g/mol |
| Exact Mass | 651.08 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1R)-1,2-dihydroxyethyl]-3,4,5-trihydroxyoxepan-2-yl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(O)(=S)OP(=O)(O)OC2OCC([C@@H](O)CO)C(O)C(O)C2O)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C18H28FN5O14P2S/c19-9-12(28)8(36-17(9)24-5-23-10-15(20)21-4-22-16(10)24)3-35-40(33,41)38-39(31,32)37-18-14(30)13(29)11(27)6(2-34-18)7(26)1-25/h4-9,11-14,17-18,25-30H,1-3H2,(H,31,32)(H,33,41)(H2,20,21,22)/t6?,7-,8+,9+,11?,12+,13?,14?,17+,18?,40?/m0/s1 |
| InChIKey | KSZALCOERUPSPJ-PDIXCJKASA-N |
| XLogP | -3.22 |
| TPSA | 294.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.46 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|