C14H24ClNO — CID 176612908
(2R,3R,4R,5S)-4-chloro-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine (PubChem CID 176612908) has the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-chloro-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine.
| Compound Name | (2R,3R,4R,5S)-4-chloro-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine |
|---|---|
| PubChem CID | 176612908 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (2R,3R,4R,5S)-4-chloro-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine |
| SMILES | C=C=C[C@@]1(Cl)[C@H](N)[C@@H](CC(C)C)O[C@H]1C(C)C |
| InChI | InChI=1S/C14H24ClNO/c1-6-7-14(15)12(16)11(8-9(2)3)17-13(14)10(4)5/h7,9-13H,1,8,16H2,2-5H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | PTOSTYRBZJMYTR-YIYPIFLZSA-N |
| XLogP | 3.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|