C18H27FN4O14P2S — CID 176612980
[[(2R,3S,4R,5S)-4-amino-5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate (PubChem CID 176612980) has the molecular formula C18H27FN4O14P2S and a molecular weight of 636.44 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-4-amino-5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5S)-4-amino-5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 176612980 |
| Molecular Formula | C18H27FN4O14P2S |
| Molecular Weight | 636.44 g/mol |
| Exact Mass | 636.07 |
| IUPAC Name | [[(2R,3S,4R,5S)-4-amino-5-(4-aminofuro[3,2-d]pyrimidin-7-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] [6-[(1S)-1-fluoro-2-hydroxyethyl]-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
| SMILES | Nc1ncnc2c([C@@H]3O[C@H](COP(O)(=S)OP(=O)(O)OC4OC([C@@H](F)CO)C(O)C(O)C4O)[C@@H](O)[C@H]3N)coc12 |
| InChI | InChI=1S/C18H27FN4O14P2S/c19-6(1-24)15-12(27)11(26)13(28)18(35-15)36-38(29,30)37-39(31,40)33-3-7-10(25)8(20)14(34-7)5-2-32-16-9(5)22-4-23-17(16)21/h2,4,6-8,10-15,18,24-28H,1,3,20H2,(H,29,30)(H,31,40)(H2,21,22,23)/t6-,7+,8+,10+,11?,12?,13?,14-,15?,18?,39?/m0/s1 |
| InChIKey | MVHVSUVVCOBESV-MYDDNVOQSA-N |
| XLogP | -2.56 |
| TPSA | 295.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.44 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|