C29H45N3O3 — CID 176615077
[(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-[2-(3-methylpyrrolidin-2-yl)ethyl]carbamate (PubChem CID 176615077) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-[2-(3-methylpyrrolidin-2-yl)ethyl]carbamate.
| Compound Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-[2-(3-methylpyrrolidin-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 176615077 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-[2-(3-methylpyrrolidin-2-yl)ethyl]carbamate |
| SMILES | C/C(=N\OC(=O)NCCC1NCCC1C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H45N3O3/c1-18-11-15-30-26(18)12-16-31-27(34)35-32-19(2)23-7-8-24-22-6-5-20-17-21(33)9-13-28(20,3)25(22)10-14-29(23,24)4/h17-18,22-26,30H,5-16H2,1-4H3,(H,31,34)/b32-19+/t18?,22-,23+,24-,25-,26?,28-,29+/m0/s1 |
| InChIKey | VSWQHTCIUPWESJ-GZRWFFBESA-N |
| XLogP | 5.62 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|