C30H47N3O3 — CID 176615223
[(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-cyclobutyl-N-[2-(ethylamino)ethyl]carbamate (PubChem CID 176615223) has the molecular formula C30H47N3O3 and a molecular weight of 497.72 g/mol. Its IUPAC name is [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-cyclobutyl-N-[2-(ethylamino)ethyl]carbamate.
| Compound Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-cyclobutyl-N-[2-(ethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 176615223 |
| Molecular Formula | C30H47N3O3 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 497.36 |
| IUPAC Name | [(E)-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethylideneamino] N-cyclobutyl-N-[2-(ethylamino)ethyl]carbamate |
| SMILES | CCNCCN(C(=O)O/N=C(\C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)C1CCC1 |
| InChI | InChI=1S/C30H47N3O3/c1-5-31-17-18-33(22-7-6-8-22)28(35)36-32-20(2)25-11-12-26-24-10-9-21-19-23(34)13-15-29(21,3)27(24)14-16-30(25,26)4/h19,22,24-27,31H,5-18H2,1-4H3/b32-20+/t24-,25+,26-,27-,29-,30+/m0/s1 |
| InChIKey | SZIPEBXMABJGSQ-ZNIHDQFDSA-N |
| XLogP | 6.11 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|