C51H99NO7 — CID 176617188
6-[(3S,4R)-4-[6-(2-hexyldecanoyloxy)hexoxy]-1-(3-hydroxypropyl)pyrrolidin-3-yl]oxyhexyl 2-hexyldecanoate (PubChem CID 176617188) has the molecular formula C51H99NO7 and a molecular weight of 838.35 g/mol. Its IUPAC name is 6-[(3S,4R)-4-[6-(2-hexyldecanoyloxy)hexoxy]-1-(3-hydroxypropyl)pyrrolidin-3-yl]oxyhexyl 2-hexyldecanoate.
| Compound Name | 6-[(3S,4R)-4-[6-(2-hexyldecanoyloxy)hexoxy]-1-(3-hydroxypropyl)pyrrolidin-3-yl]oxyhexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 176617188 |
| Molecular Formula | C51H99NO7 |
| Molecular Weight | 838.35 g/mol |
| Exact Mass | 837.74 |
| IUPAC Name | 6-[(3S,4R)-4-[6-(2-hexyldecanoyloxy)hexoxy]-1-(3-hydroxypropyl)pyrrolidin-3-yl]oxyhexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCO[C@H]1CN(CCCO)C[C@H]1OCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H99NO7/c1-5-9-13-17-19-27-36-46(34-25-15-11-7-3)50(54)58-42-31-23-21-29-40-56-48-44-52(38-33-39-53)45-49(48)57-41-30-22-24-32-43-59-51(55)47(35-26-16-12-8-4)37-28-20-18-14-10-6-2/h46-49,53H,5-45H2,1-4H3/t46?,47?,48-,49+ |
| InChIKey | AQQNMFIQDIYENU-NCNXLCFASA-N |
| XLogP | 13.34 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.35 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|