C44H85NO7 — CID 171074034
[5-(2-hexyldecanoyloxymethyl)-3,6-dihydroxy-1-(4-hydroxybutyl)azepan-4-yl]methyl 2-hexyldecanoate (PubChem CID 171074034) has the molecular formula C44H85NO7 and a molecular weight of 740.16 g/mol. Its IUPAC name is [5-(2-hexyldecanoyloxymethyl)-3,6-dihydroxy-1-(4-hydroxybutyl)azepan-4-yl]methyl 2-hexyldecanoate.
| Compound Name | [5-(2-hexyldecanoyloxymethyl)-3,6-dihydroxy-1-(4-hydroxybutyl)azepan-4-yl]methyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171074034 |
| Molecular Formula | C44H85NO7 |
| Molecular Weight | 740.16 g/mol |
| Exact Mass | 739.63 |
| IUPAC Name | [5-(2-hexyldecanoyloxymethyl)-3,6-dihydroxy-1-(4-hydroxybutyl)azepan-4-yl]methyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCC1C(O)CN(CCCCO)CC(O)C1COC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C44H85NO7/c1-5-9-13-17-19-23-29-37(27-21-15-11-7-3)43(49)51-35-39-40(42(48)34-45(33-41(39)47)31-25-26-32-46)36-52-44(50)38(28-22-16-12-8-4)30-24-20-18-14-10-6-2/h37-42,46-48H,5-36H2,1-4H3 |
| InChIKey | CANKNDOBTCDZJH-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.16 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|