C47H89NO5 — CID 171548398
[(2R,3R)-3-(2-heptyldecanoyloxy)-8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-2-yl] 2-heptyldecanoate (PubChem CID 171548398) has the molecular formula C47H89NO5 and a molecular weight of 748.23 g/mol. Its IUPAC name is [(2R,3R)-3-(2-heptyldecanoyloxy)-8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-2-yl] 2-heptyldecanoate.
| Compound Name | [(2R,3R)-3-(2-heptyldecanoyloxy)-8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-2-yl] 2-heptyldecanoate |
|---|---|
| PubChem CID | 171548398 |
| Molecular Formula | C47H89NO5 |
| Molecular Weight | 748.23 g/mol |
| Exact Mass | 747.67 |
| IUPAC Name | [(2R,3R)-3-(2-heptyldecanoyloxy)-8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-2-yl] 2-heptyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCC)C(=O)O[C@@H]1CC2(CCN(CCCCO)CC2)C[C@H]1OC(=O)C(CCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H89NO5/c1-5-9-13-17-21-25-31-41(29-23-19-15-11-7-3)45(50)52-43-39-47(33-36-48(37-34-47)35-27-28-38-49)40-44(43)53-46(51)42(30-24-20-16-12-8-4)32-26-22-18-14-10-6-2/h41-44,49H,5-40H2,1-4H3/t41?,42?,43-,44-/m1/s1 |
| InChIKey | ISSLFQADZIMEJB-YNJSGQQPSA-N |
| XLogP | 12.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.23 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|