C49H87N3O6 — CID 171548425
[(2R,3R)-3-(2-heptylnonanoyloxy)-8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]-8-azaspiro[4.5]decan-2-yl] 2-heptylnonanoate (PubChem CID 171548425) has the molecular formula C49H87N3O6 and a molecular weight of 814.25 g/mol. Its IUPAC name is [(2R,3R)-3-(2-heptylnonanoyloxy)-8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]-8-azaspiro[4.5]decan-2-yl] 2-heptylnonanoate.
| Compound Name | [(2R,3R)-3-(2-heptylnonanoyloxy)-8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]-8-azaspiro[4.5]decan-2-yl] 2-heptylnonanoate |
|---|---|
| PubChem CID | 171548425 |
| Molecular Formula | C49H87N3O6 |
| Molecular Weight | 814.25 g/mol |
| Exact Mass | 813.66 |
| IUPAC Name | [(2R,3R)-3-(2-heptylnonanoyloxy)-8-[3-[[2-(methylamino)-3,4-dioxocyclobuten-1-yl]amino]propyl]-8-azaspiro[4.5]decan-2-yl] 2-heptylnonanoate |
| SMILES | CCCCCCCC(CCCCCCC)C(=O)O[C@@H]1CC2(CCN(CCCNc3c(NC)c(=O)c3=O)CC2)C[C@H]1OC(=O)C(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C49H87N3O6/c1-6-10-14-18-22-27-39(28-23-19-15-11-7-2)47(55)57-41-37-49(31-35-52(36-32-49)34-26-33-51-44-43(50-5)45(53)46(44)54)38-42(41)58-48(56)40(29-24-20-16-12-8-3)30-25-21-17-13-9-4/h39-42,50-51H,6-38H2,1-5H3/t41-,42-/m1/s1 |
| InChIKey | XIKPYDLFOIJKME-NCRNUEESSA-N |
| XLogP | 11.50 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.25 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|