C49H95N3O6S — CID 171548406
[2-[9-[3-(ethylsulfonylamino)propyl]-3,9-diazaspiro[5.5]undecan-3-yl]-3-(2-hexyldecanoyloxy)propyl] 2-hexyldecanoate (PubChem CID 171548406) has the molecular formula C49H95N3O6S and a molecular weight of 854.38 g/mol. Its IUPAC name is [2-[9-[3-(ethylsulfonylamino)propyl]-3,9-diazaspiro[5.5]undecan-3-yl]-3-(2-hexyldecanoyloxy)propyl] 2-hexyldecanoate.
| Compound Name | [2-[9-[3-(ethylsulfonylamino)propyl]-3,9-diazaspiro[5.5]undecan-3-yl]-3-(2-hexyldecanoyloxy)propyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 171548406 |
| Molecular Formula | C49H95N3O6S |
| Molecular Weight | 854.38 g/mol |
| Exact Mass | 853.69 |
| IUPAC Name | [2-[9-[3-(ethylsulfonylamino)propyl]-3,9-diazaspiro[5.5]undecan-3-yl]-3-(2-hexyldecanoyloxy)propyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCC(COC(=O)C(CCCCCC)CCCCCCCC)N1CCC2(CCN(CCCNS(=O)(=O)CC)CC2)CC1 |
| InChI | InChI=1S/C49H95N3O6S/c1-6-11-15-19-21-25-30-44(28-23-17-13-8-3)47(53)57-42-46(43-58-48(54)45(29-24-18-14-9-4)31-26-22-20-16-12-7-2)52-40-34-49(35-41-52)32-38-51(39-33-49)37-27-36-50-59(55,56)10-5/h44-46,50H,6-43H2,1-5H3 |
| InChIKey | KDEYNSWGEBGUAU-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.38 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|