C32H62N2O7 — CID 171548550
[2-[2-(4-hydroxybutyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-methoxypropyl] 2-heptyl-9,9,9-trihydroxynonanoate (PubChem CID 171548550) has the molecular formula C32H62N2O7 and a molecular weight of 586.86 g/mol. Its IUPAC name is [2-[2-(4-hydroxybutyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-methoxypropyl] 2-heptyl-9,9,9-trihydroxynonanoate.
| Compound Name | [2-[2-(4-hydroxybutyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-methoxypropyl] 2-heptyl-9,9,9-trihydroxynonanoate |
|---|---|
| PubChem CID | 171548550 |
| Molecular Formula | C32H62N2O7 |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 586.46 |
| IUPAC Name | [2-[2-(4-hydroxybutyl)-2,8-diazaspiro[4.5]decan-8-yl]-3-methoxypropyl] 2-heptyl-9,9,9-trihydroxynonanoate |
| SMILES | CCCCCCCC(CCCCCCC(O)(O)O)C(=O)OCC(COC)N1CCC2(CCN(CCCCO)C2)CC1 |
| InChI | InChI=1S/C32H62N2O7/c1-3-4-5-6-9-14-28(15-10-7-8-11-16-32(37,38)39)30(36)41-26-29(25-40-2)34-22-18-31(19-23-34)17-21-33(27-31)20-12-13-24-35/h28-29,35,37-39H,3-27H2,1-2H3 |
| InChIKey | JNUZGXNZCLUISJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|