C47H90N2O5 — CID 171548509
[3-(2-hexyldecanoyloxy)-2-[7-(5-hydroxypentyl)-2,7-diazaspiro[4.4]nonan-2-yl]propyl] 2-hexyldecanoate (PubChem CID 171548509) has the molecular formula C47H90N2O5 and a molecular weight of 763.25 g/mol. Its IUPAC name is [3-(2-hexyldecanoyloxy)-2-[7-(5-hydroxypentyl)-2,7-diazaspiro[4.4]nonan-2-yl]propyl] 2-hexyldecanoate.
| Compound Name | [3-(2-hexyldecanoyloxy)-2-[7-(5-hydroxypentyl)-2,7-diazaspiro[4.4]nonan-2-yl]propyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 171548509 |
| Molecular Formula | C47H90N2O5 |
| Molecular Weight | 763.25 g/mol |
| Exact Mass | 762.68 |
| IUPAC Name | [3-(2-hexyldecanoyloxy)-2-[7-(5-hydroxypentyl)-2,7-diazaspiro[4.4]nonan-2-yl]propyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCC(COC(=O)C(CCCCCC)CCCCCCCC)N1CCC2(CCN(CCCCCO)C2)C1 |
| InChI | InChI=1S/C47H90N2O5/c1-5-9-13-17-19-24-30-42(28-22-15-11-7-3)45(51)53-38-44(49-36-33-47(41-49)32-35-48(40-47)34-26-21-27-37-50)39-54-46(52)43(29-23-16-12-8-4)31-25-20-18-14-10-6-2/h42-44,50H,5-41H2,1-4H3 |
| InChIKey | IMBFGWXPRKAICQ-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.25 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|