C46H89NO16 — CID 171548488
[8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-3-yl] 10,10-dihydroxy-2-(6,6,6-trihydroxyhexyl)undecanoate;10,10,10-trihydroxy-2-(6,6,6-trihydroxyhexyl)decanoic acid (PubChem CID 171548488) has the molecular formula C46H89NO16 and a molecular weight of 912.21 g/mol. Its IUPAC name is [8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-3-yl] 10,10-dihydroxy-2-(6,6,6-trihydroxyhexyl)undecanoate;10,10,10-trihydroxy-2-(6,6,6-trihydroxyhexyl)decanoic acid.
| Compound Name | [8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-3-yl] 10,10-dihydroxy-2-(6,6,6-trihydroxyhexyl)undecanoate;10,10,10-trihydroxy-2-(6,6,6-trihydroxyhexyl)decanoic acid |
|---|---|
| PubChem CID | 171548488 |
| Molecular Formula | C46H89NO16 |
| Molecular Weight | 912.21 g/mol |
| Exact Mass | 911.62 |
| IUPAC Name | [8-(4-hydroxybutyl)-8-azaspiro[4.5]decan-3-yl] 10,10-dihydroxy-2-(6,6,6-trihydroxyhexyl)undecanoate;10,10,10-trihydroxy-2-(6,6,6-trihydroxyhexyl)decanoic acid |
| SMILES | CC(O)(O)CCCCCCCC(CCCCCC(O)(O)O)C(=O)OC1CCC2(CCN(CCCCO)CC2)C1.O=C(O)C(CCCCCCCC(O)(O)O)CCCCCC(O)(O)O |
| InChI | InChI=1S/C30H57NO8.C16H32O8/c1-28(34,35)15-8-4-2-3-6-12-25(13-7-5-9-16-30(36,37)38)27(33)39-26-14-17-29(24-26)18-21-31(22-19-29)20-10-11-23-32;17-14(18)13(10-6-4-8-12-16(22,23)24)9-5-2-1-3-7-11-15(19,20)21/h25-26,32,34-38H,2-24H2,1H3;13,19-24H,1-12H2,(H,17,18) |
| InChIKey | QMBDNVHGDBMPTA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 309.60 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|