C15H29NO2 — CID 106714030
6-(4,4-dimethylpiperidin-1-yl)-2,2-dimethylhexanoic acid (PubChem CID 106714030) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 6-(4,4-dimethylpiperidin-1-yl)-2,2-dimethylhexanoic acid.
| Compound Name | 6-(4,4-dimethylpiperidin-1-yl)-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714030 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 6-(4,4-dimethylpiperidin-1-yl)-2,2-dimethylhexanoic acid |
| SMILES | CC1(C)CCN(CCCCC(C)(C)C(=O)O)CC1 |
| InChI | InChI=1S/C15H29NO2/c1-14(2)8-11-16(12-9-14)10-6-5-7-15(3,4)13(17)18/h5-12H2,1-4H3,(H,17,18) |
| InChIKey | VIFWWUFZQHUFTD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|