C16H32N2O2 — CID 65281759
6-(4,4-dimethylazepan-1-yl)-2-methyl-2-(methylamino)hexanoic acid (PubChem CID 65281759) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 6-(4,4-dimethylazepan-1-yl)-2-methyl-2-(methylamino)hexanoic acid.
| Compound Name | 6-(4,4-dimethylazepan-1-yl)-2-methyl-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 65281759 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 6-(4,4-dimethylazepan-1-yl)-2-methyl-2-(methylamino)hexanoic acid |
| SMILES | CNC(C)(CCCCN1CCCC(C)(C)CC1)C(=O)O |
| InChI | InChI=1S/C16H32N2O2/c1-15(2)8-7-12-18(13-10-15)11-6-5-9-16(3,17-4)14(19)20/h17H,5-13H2,1-4H3,(H,19,20) |
| InChIKey | RKRZTGPMSFKEJX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|