C16H32N2O2 — CID 65281847
methyl 2-amino-6-(4,4-dimethylazepan-1-yl)-2-methylhexanoate (PubChem CID 65281847) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is methyl 2-amino-6-(4,4-dimethylazepan-1-yl)-2-methylhexanoate.
| Compound Name | methyl 2-amino-6-(4,4-dimethylazepan-1-yl)-2-methylhexanoate |
|---|---|
| PubChem CID | 65281847 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | methyl 2-amino-6-(4,4-dimethylazepan-1-yl)-2-methylhexanoate |
| SMILES | COC(=O)C(C)(N)CCCCN1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C16H32N2O2/c1-15(2)8-7-12-18(13-10-15)11-6-5-9-16(3,17)14(19)20-4/h5-13,17H2,1-4H3 |
| InChIKey | KHMUOJDIMOJKMJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|