C16H32ClNO2 — CID 119040963
tert-butyl 4-(4,4-dimethylazepan-1-yl)butanoate;hydrochloride (PubChem CID 119040963) has the molecular formula C16H32ClNO2 and a molecular weight of 305.89 g/mol. Its IUPAC name is tert-butyl 4-(4,4-dimethylazepan-1-yl)butanoate;hydrochloride.
| Compound Name | tert-butyl 4-(4,4-dimethylazepan-1-yl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 119040963 |
| Molecular Formula | C16H32ClNO2 |
| Molecular Weight | 305.89 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | tert-butyl 4-(4,4-dimethylazepan-1-yl)butanoate;hydrochloride |
| SMILES | CC1(C)CCCN(CCCC(=O)OC(C)(C)C)CC1.Cl |
| InChI | InChI=1S/C16H31NO2.ClH/c1-15(2,3)19-14(18)8-6-11-17-12-7-9-16(4,5)10-13-17;/h6-13H2,1-5H3;1H |
| InChIKey | RFLIANVBCSALTM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |