C53H105N3O4 — CID 177148800
6-[6-[6-(2-heptylnonanimidoyloxy)hexyl]-4-(5-hydroxypentyl)piperazin-2-yl]hexyl 2-heptylnonanoate (PubChem CID 177148800) has the molecular formula C53H105N3O4 and a molecular weight of 848.44 g/mol. Its IUPAC name is 6-[6-[6-(2-heptylnonanimidoyloxy)hexyl]-4-(5-hydroxypentyl)piperazin-2-yl]hexyl 2-heptylnonanoate.
| Compound Name | 6-[6-[6-(2-heptylnonanimidoyloxy)hexyl]-4-(5-hydroxypentyl)piperazin-2-yl]hexyl 2-heptylnonanoate |
|---|---|
| PubChem CID | 177148800 |
| Molecular Formula | C53H105N3O4 |
| Molecular Weight | 848.44 g/mol |
| Exact Mass | 847.81 |
| IUPAC Name | 6-[6-[6-(2-heptylnonanimidoyloxy)hexyl]-4-(5-hydroxypentyl)piperazin-2-yl]hexyl 2-heptylnonanoate |
| SMILES | [H]/N=C(/OCCCCCCC1CN(CCCCCO)CC(CCCCCCOC(=O)C(CCCCCCC)CCCCCCC)N1)C(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C53H105N3O4/c1-5-9-13-17-26-36-48(37-27-18-14-10-6-2)52(54)59-44-34-23-21-30-40-50-46-56(42-32-25-33-43-57)47-51(55-50)41-31-22-24-35-45-60-53(58)49(38-28-19-15-11-7-3)39-29-20-16-12-8-4/h48-51,54-55,57H,5-47H2,1-4H3/b54-52+ |
| InChIKey | XXWNUWYBAYOANS-LTVAWKPISA-N |
| XLogP | 14.90 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.44 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|