C54H106N2O3 — CID 177148784
3-[3-[6-(3-hexylundec-1-en-2-yloxy)hexyl]-5-[6-[3-(2-methylhexyl)undec-1-en-2-yloxy]hexyl]piperazin-1-yl]propan-1-ol (PubChem CID 177148784) has the molecular formula C54H106N2O3 and a molecular weight of 831.45 g/mol. Its IUPAC name is 3-[3-[6-(3-hexylundec-1-en-2-yloxy)hexyl]-5-[6-[3-(2-methylhexyl)undec-1-en-2-yloxy]hexyl]piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[3-[6-(3-hexylundec-1-en-2-yloxy)hexyl]-5-[6-[3-(2-methylhexyl)undec-1-en-2-yloxy]hexyl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 177148784 |
| Molecular Formula | C54H106N2O3 |
| Molecular Weight | 831.45 g/mol |
| Exact Mass | 830.82 |
| IUPAC Name | 3-[3-[6-(3-hexylundec-1-en-2-yloxy)hexyl]-5-[6-[3-(2-methylhexyl)undec-1-en-2-yloxy]hexyl]piperazin-1-yl]propan-1-ol |
| SMILES | C=C(OCCCCCCC1CN(CCCO)CC(CCCCCCOC(=C)C(CCCCCCCC)CC(C)CCCC)N1)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C54H106N2O3/c1-8-12-16-19-21-28-37-51(36-27-18-14-10-3)49(6)58-43-32-25-23-30-39-53-46-56(41-34-42-57)47-54(55-53)40-31-24-26-33-44-59-50(7)52(45-48(5)35-15-11-4)38-29-22-20-17-13-9-2/h48,51-55,57H,6-47H2,1-5H3 |
| InChIKey | KLWVFVVDNBUGPP-UHFFFAOYSA-N |
| XLogP | 15.89 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.45 |
| LogP ≤ 5 | 15.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|