C39H77NO4 — CID 170567551
9-[9-(3-ethylhept-1-en-2-yloxy)nonyl-(4-hydroxybutyl)amino]nonyl 2-ethylhexanoate (PubChem CID 170567551) has the molecular formula C39H77NO4 and a molecular weight of 624.05 g/mol. Its IUPAC name is 9-[9-(3-ethylhept-1-en-2-yloxy)nonyl-(4-hydroxybutyl)amino]nonyl 2-ethylhexanoate.
| Compound Name | 9-[9-(3-ethylhept-1-en-2-yloxy)nonyl-(4-hydroxybutyl)amino]nonyl 2-ethylhexanoate |
|---|---|
| PubChem CID | 170567551 |
| Molecular Formula | C39H77NO4 |
| Molecular Weight | 624.05 g/mol |
| Exact Mass | 623.59 |
| IUPAC Name | 9-[9-(3-ethylhept-1-en-2-yloxy)nonyl-(4-hydroxybutyl)amino]nonyl 2-ethylhexanoate |
| SMILES | C=C(OCCCCCCCCCN(CCCCO)CCCCCCCCCOC(=O)C(CC)CCCC)C(CC)CCCC |
| InChI | InChI=1S/C39H77NO4/c1-6-10-28-37(8-3)36(5)43-34-26-20-16-12-14-18-22-30-40(32-24-25-33-41)31-23-19-15-13-17-21-27-35-44-39(42)38(9-4)29-11-7-2/h37-38,41H,5-35H2,1-4H3 |
| InChIKey | CKCZGEYGFRAOSZ-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.05 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|