C38H75INO5+ — CID 170760606
ethyl-[1-[9-[9-(2-ethylhexanoyloxy)nonyl-(4-hydroxybutyl)amino]nonoxy]-1-oxohexan-2-yl]iodanium (PubChem CID 170760606) has the molecular formula C38H75INO5+ and a molecular weight of 752.92 g/mol. Its IUPAC name is ethyl-[1-[9-[9-(2-ethylhexanoyloxy)nonyl-(4-hydroxybutyl)amino]nonoxy]-1-oxohexan-2-yl]iodanium.
| Compound Name | ethyl-[1-[9-[9-(2-ethylhexanoyloxy)nonyl-(4-hydroxybutyl)amino]nonoxy]-1-oxohexan-2-yl]iodanium |
|---|---|
| PubChem CID | 170760606 |
| Molecular Formula | C38H75INO5+ |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.47 |
| IUPAC Name | ethyl-[1-[9-[9-(2-ethylhexanoyloxy)nonyl-(4-hydroxybutyl)amino]nonoxy]-1-oxohexan-2-yl]iodanium |
| SMILES | CCCCC(CC)C(=O)OCCCCCCCCCN(CCCCO)CCCCCCCCCOC(=O)C(CCCC)[I+]CC |
| InChI | InChI=1S/C38H75INO5/c1-5-9-27-35(7-3)37(42)44-33-25-19-15-11-13-17-21-29-40(31-23-24-32-41)30-22-18-14-12-16-20-26-34-45-38(43)36(39-8-4)28-10-6-2/h35-36,41H,5-34H2,1-4H3/q+1 |
| InChIKey | OAAKNPCJICFCJK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|