About 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate
8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate (PubChem CID 177144109) has the molecular formula C29H60N2O3
and a molecular weight of 484.81 g/mol. Its IUPAC name is 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate |
| PubChem CID | 177144109 |
| Molecular Formula | C29H60N2O3 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.46 |
| IUPAC Name | 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCCCCCCCCN(CCCCCCCCOC)CCN(C)C |
| InChI | InChI=1S/C29H60N2O3/c1-6-8-21-28(7-2)29(32)34-27-20-16-12-10-14-18-23-31(25-24-30(3)4)22-17-13-9-11-15-19-26-33-5/h28H,6-27H2,1-5H3 |
| InChIKey | GSNDKIFNOCWKSV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate?
The IUPAC name of 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate (CID 177144109) is 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate.
What is the SMILES notation for 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate?
The canonical SMILES for 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate is CCCCC(CC)C(=O)OCCCCCCCCN(CCCCCCCCOC)CCN(C)C.
What is the InChIKey of 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate?
The InChIKey is GSNDKIFNOCWKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H60N2O3/c1-6-8-21-28(7-2)29(32)34-27-20-16-12-10-14-18-23-31(25-24-30(3)4)22-17-13-9-11-15-19-26-33-5/h28H,6-27H2,1-5H3.
What are the key properties of 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate?
8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate has a molecular weight of 484.81 g/mol, XLogP of 6.94, 26 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(dimethylamino)ethyl-(8-methoxyoctyl)amino]octyl 2-ethylhexanoate is sourced from PubChem (CID 177144109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).