C14H27NO5 — CID 176618115
tert-butyl 2-[2-[3-hydroxypropyl(methyl)amino]acetyl]oxy-2-methylpropanoate (PubChem CID 176618115) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-hydroxypropyl(methyl)amino]acetyl]oxy-2-methylpropanoate.
| Compound Name | tert-butyl 2-[2-[3-hydroxypropyl(methyl)amino]acetyl]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 176618115 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | tert-butyl 2-[2-[3-hydroxypropyl(methyl)amino]acetyl]oxy-2-methylpropanoate |
| SMILES | CN(CCCO)CC(=O)OC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO5/c1-13(2,3)20-12(18)14(4,5)19-11(17)10-15(6)8-7-9-16/h16H,7-10H2,1-6H3 |
| InChIKey | ALRFMJHKXAGEBQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |