C12H23NO6 — CID 169192087
2-[2-[bis(3-hydroxypropyl)amino]acetyl]oxy-2-methylpropanoic acid (PubChem CID 169192087) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[2-[bis(3-hydroxypropyl)amino]acetyl]oxy-2-methylpropanoic acid.
| Compound Name | 2-[2-[bis(3-hydroxypropyl)amino]acetyl]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 169192087 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[2-[bis(3-hydroxypropyl)amino]acetyl]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(OC(=O)CN(CCCO)CCCO)C(=O)O |
| InChI | InChI=1S/C12H23NO6/c1-12(2,11(17)18)19-10(16)9-13(5-3-7-14)6-4-8-15/h14-15H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | ZZZUSDYCANGCOR-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |