About 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten
2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten (PubChem CID 169191964) has the molecular formula C8H15NO5W
and a molecular weight of 389.05 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten |
| PubChem CID | 169191964 |
| Molecular Formula | C8H15NO5W |
| Molecular Weight | 389.05 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten |
| SMILES | CC(C)(OC(=O)CNCCO)C(=O)O.[W] |
| InChI | InChI=1S/C8H15NO5.W/c1-8(2,7(12)13)14-6(11)5-9-3-4-10;/h9-10H,3-5H2,1-2H3,(H,12,13); |
| InChIKey | ITSKNEHGDSMVLE-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.05 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten?
The IUPAC name of 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten (CID 169191964) is 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten.
What is the SMILES notation for 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten?
The canonical SMILES for 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten is CC(C)(OC(=O)CNCCO)C(=O)O.[W].
What is the InChIKey of 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten?
The InChIKey is ITSKNEHGDSMVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO5.W/c1-8(2,7(12)13)14-6(11)5-9-3-4-10;/h9-10H,3-5H2,1-2H3,(H,12,13);.
What are the key properties of 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten?
2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten has a molecular weight of 389.05 g/mol, XLogP of -1.03, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethylamino)acetyl]oxy-2-methylpropanoic acid;tungsten is sourced from PubChem (CID 169191964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).