C13H28N2O11 — CID 173435431
bis(2-(2-hydroxyethylamino)ethanol);methoxymethanetricarboxylic acid (PubChem CID 173435431) has the molecular formula C13H28N2O11 and a molecular weight of 388.37 g/mol. Its IUPAC name is bis(2-(2-hydroxyethylamino)ethanol);methoxymethanetricarboxylic acid.
| Compound Name | bis(2-(2-hydroxyethylamino)ethanol);methoxymethanetricarboxylic acid |
|---|---|
| PubChem CID | 173435431 |
| Molecular Formula | C13H28N2O11 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | bis(2-(2-hydroxyethylamino)ethanol);methoxymethanetricarboxylic acid |
| SMILES | COC(C(=O)O)(C(=O)O)C(=O)O.OCCNCCO.OCCNCCO |
| InChI | InChI=1S/C5H6O7.2C4H11NO2/c1-12-5(2(6)7,3(8)9)4(10)11;2*6-3-1-5-2-4-7/h1H3,(H,6,7)(H,8,9)(H,10,11);2*5-7H,1-4H2 |
| InChIKey | XIKJVDRATOCMSW-UHFFFAOYSA-N |
| XLogP | -4.25 |
| TPSA | 226.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|