C26H43NO4 — CID 176618131
[(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(2-hydroxyethylamino)acetate (PubChem CID 176618131) has the molecular formula C26H43NO4 and a molecular weight of 433.63 g/mol. Its IUPAC name is [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(2-hydroxyethylamino)acetate.
| Compound Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(2-hydroxyethylamino)acetate |
|---|---|
| PubChem CID | 176618131 |
| Molecular Formula | C26H43NO4 |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-(2-hydroxyethylamino)acetate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@](C)(OC(=O)CNCCO)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H43NO4/c1-17(29)20-7-8-21-19-6-5-18-15-24(2,31-23(30)16-27-13-14-28)11-12-25(18,3)22(19)9-10-26(20,21)4/h18-22,27-28H,5-16H2,1-4H3/t18-,19-,20+,21-,22-,24+,25-,26+/m0/s1 |
| InChIKey | PZQXAEYBQYMLHF-MLFNHLSZSA-N |
| XLogP | 4.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|