C30H46O3 — CID 156845751
[(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopent-3-en-1-ylpropanoate (PubChem CID 156845751) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopent-3-en-1-ylpropanoate.
| Compound Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopent-3-en-1-ylpropanoate |
|---|---|
| PubChem CID | 156845751 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-17-acetyl-3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopent-3-en-1-ylpropanoate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@](C)(OC(=O)CCC5CC=CC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H46O3/c1-20(31)24-12-13-25-23-11-10-22-19-28(2,33-27(32)14-9-21-7-5-6-8-21)17-18-29(22,3)26(23)15-16-30(24,25)4/h5-6,21-26H,7-19H2,1-4H3/t22-,23-,24+,25-,26-,28+,29-,30+/m0/s1 |
| InChIKey | MJXSBGQTBHTILG-RRJLJTPVSA-N |
| XLogP | 7.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|