C19H22N4 — CID 176618664
N'-isoquinolin-7-yl-N-(pyridin-2-ylmethyl)butane-1,4-diamine (PubChem CID 176618664) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is N'-isoquinolin-7-yl-N-(pyridin-2-ylmethyl)butane-1,4-diamine.
| Compound Name | N'-isoquinolin-7-yl-N-(pyridin-2-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 176618664 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N'-isoquinolin-7-yl-N-(pyridin-2-ylmethyl)butane-1,4-diamine |
| SMILES | c1ccc(CNCCCCNc2ccc3ccncc3c2)nc1 |
| InChI | InChI=1S/C19H22N4/c1-2-10-23-19(5-1)15-20-9-3-4-11-22-18-7-6-16-8-12-21-14-17(16)13-18/h1-2,5-8,10,12-14,20,22H,3-4,9,11,15H2 |
| InChIKey | KXGABDMXYFIPBU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|