C28H22ClF4N5O2 — CID 176620001
trans-(1S,3S)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,3-dihydroisoindol-4-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 176620001) has the molecular formula C28H22ClF4N5O2 and a molecular weight of 571.96 g/mol. Its IUPAC name is trans-(1S,3S)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,3-dihydroisoindol-4-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,3S)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,3-dihydroisoindol-4-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 176620001 |
| Molecular Formula | C28H22ClF4N5O2 |
| Molecular Weight | 571.96 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | trans-(1S,3S)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-2,3-dihydroisoindol-4-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C1NC(c2cc(F)ccc2Cl)c2c(NC(=O)[C@H]3CCC[C@H](C(F)(F)F)C3)cc(-c3ccc4ncnn4c3)cc21 |
| InChI | InChI=1S/C28H22ClF4N5O2/c29-21-6-5-18(30)11-19(21)25-24-20(27(40)37-25)9-16(15-4-7-23-34-13-35-38(23)12-15)10-22(24)36-26(39)14-2-1-3-17(8-14)28(31,32)33/h4-7,9-14,17,25H,1-3,8H2,(H,36,39)(H,37,40)/t14-,17-,25?/m0/s1 |
| InChIKey | SKZBYQDOMISWRO-VCUATYFUSA-N |
| XLogP | 6.33 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.96 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |