C14H19ClN2O2 — CID 176622810
tert-butyl N-(5-chloro-4-prop-2-enyl-2-pyridinyl)-N-methylcarbamate (PubChem CID 176622810) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-4-prop-2-enyl-2-pyridinyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(5-chloro-4-prop-2-enyl-2-pyridinyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 176622810 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | tert-butyl N-(5-chloro-4-prop-2-enyl-2-pyridinyl)-N-methylcarbamate |
| SMILES | C=CCc1cc(N(C)C(=O)OC(C)(C)C)ncc1Cl |
| InChI | InChI=1S/C14H19ClN2O2/c1-6-7-10-8-12(16-9-11(10)15)17(5)13(18)19-14(2,3)4/h6,8-9H,1,7H2,2-5H3 |
| InChIKey | XTIQMNVHIYTXOK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|