C10H18O2S — CID 176625279
(2R)-2-propan-2-yl-6λ6-thiaspiro[2.5]octane 6,6-dioxide (PubChem CID 176625279) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is (2R)-2-propan-2-yl-6λ6-thiaspiro[2.5]octane 6,6-dioxide.
| Compound Name | (2R)-2-propan-2-yl-6λ6-thiaspiro[2.5]octane 6,6-dioxide |
|---|---|
| PubChem CID | 176625279 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2R)-2-propan-2-yl-6λ6-thiaspiro[2.5]octane 6,6-dioxide |
| SMILES | CC(C)[C@H]1CC12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C10H18O2S/c1-8(2)9-7-10(9)3-5-13(11,12)6-4-10/h8-9H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | GHWHQQIMSXXIBR-SECBINFHSA-N |
| XLogP | 1.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |