C9H19NO2S — CID 146946507
4-methyl-1,1-dioxo-N-propan-2-ylthian-4-amine (PubChem CID 146946507) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-N-propan-2-ylthian-4-amine.
| Compound Name | 4-methyl-1,1-dioxo-N-propan-2-ylthian-4-amine |
|---|---|
| PubChem CID | 146946507 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4-methyl-1,1-dioxo-N-propan-2-ylthian-4-amine |
| SMILES | CC(C)NC1(C)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19NO2S/c1-8(2)10-9(3)4-6-13(11,12)7-5-9/h8,10H,4-7H2,1-3H3 |
| InChIKey | AHWVUGFBSPYKHB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |