C26H27N3O5 — CID 176626442
[3-[4-[2-[4-(2-acetylpyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl] carbamate (PubChem CID 176626442) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is [3-[4-[2-[4-(2-acetylpyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl] carbamate.
| Compound Name | [3-[4-[2-[4-(2-acetylpyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl] carbamate |
|---|---|
| PubChem CID | 176626442 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [3-[4-[2-[4-(2-acetylpyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutyl] carbamate |
| SMILES | CC(=O)c1ncc(Oc2ccc(C(C)(C)c3ccc(OC4CC(OC(N)=O)C4)cc3)cc2)cn1 |
| InChI | InChI=1S/C26H27N3O5/c1-16(30)24-28-14-23(15-29-24)33-20-10-6-18(7-11-20)26(2,3)17-4-8-19(9-5-17)32-21-12-22(13-21)34-25(27)31/h4-11,14-15,21-22H,12-13H2,1-3H3,(H2,27,31) |
| InChIKey | RVLCIYBSMBOOTP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |