C24H24N4O2 — CID 176625756
3-[4-[2-[4-(2-isocyanopyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutan-1-amine (PubChem CID 176625756) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[4-[2-[4-(2-isocyanopyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutan-1-amine.
| Compound Name | 3-[4-[2-[4-(2-isocyanopyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutan-1-amine |
|---|---|
| PubChem CID | 176625756 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 3-[4-[2-[4-(2-isocyanopyrimidin-5-yl)oxyphenyl]propan-2-yl]phenoxy]cyclobutan-1-amine |
| SMILES | [C-]#[N+]c1ncc(Oc2ccc(C(C)(C)c3ccc(OC4CC(N)C4)cc3)cc2)cn1 |
| InChI | InChI=1S/C24H24N4O2/c1-24(2,16-4-8-19(9-5-16)29-21-12-18(25)13-21)17-6-10-20(11-7-17)30-22-14-27-23(26-3)28-15-22/h4-11,14-15,18,21H,12-13,25H2,1-2H3 |
| InChIKey | YRIBIABXLHVPEN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 74.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|