C25H37FN2O5 — CID 176629230
butyl (2S,4R)-1-[(2S)-2-(1-adamantyl)-2-[(1-fluorocyclopropanecarbonyl)amino]acetyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 176629230) has the molecular formula C25H37FN2O5 and a molecular weight of 464.58 g/mol. Its IUPAC name is butyl (2S,4R)-1-[(2S)-2-(1-adamantyl)-2-[(1-fluorocyclopropanecarbonyl)amino]acetyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | butyl (2S,4R)-1-[(2S)-2-(1-adamantyl)-2-[(1-fluorocyclopropanecarbonyl)amino]acetyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 176629230 |
| Molecular Formula | C25H37FN2O5 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | butyl (2S,4R)-1-[(2S)-2-(1-adamantyl)-2-[(1-fluorocyclopropanecarbonyl)amino]acetyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](NC(=O)C1(F)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H37FN2O5/c1-2-3-6-33-22(31)19-10-18(29)14-28(19)21(30)20(27-23(32)25(26)4-5-25)24-11-15-7-16(12-24)9-17(8-15)13-24/h15-20,29H,2-14H2,1H3,(H,27,32)/t15?,16?,17?,18-,19+,20-,24?/m1/s1 |
| InChIKey | JLZOUUCWSXLBQO-KCBRSYDOSA-N |
| XLogP | 2.49 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|