C19H31FN2O4 — CID 176629094
butyl (2S,4R)-1-[(2R)-2-amino-2-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 176629094) has the molecular formula C19H31FN2O4 and a molecular weight of 370.47 g/mol. Its IUPAC name is butyl (2S,4R)-1-[(2R)-2-amino-2-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | butyl (2S,4R)-1-[(2R)-2-amino-2-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 176629094 |
| Molecular Formula | C19H31FN2O4 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | butyl (2S,4R)-1-[(2R)-2-amino-2-(4-fluoro-1-bicyclo[2.2.2]octanyl)acetyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@H](N)C12CCC(F)(CC1)CC2 |
| InChI | InChI=1S/C19H31FN2O4/c1-2-3-10-26-17(25)14-11-13(23)12-22(14)16(24)15(21)18-4-7-19(20,8-5-18)9-6-18/h13-15,23H,2-12,21H2,1H3/t13-,14+,15+,18?,19?/m1/s1 |
| InChIKey | AMVSIWBCBOLELK-OCWVDJPHSA-N |
| XLogP | 1.68 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|