C23H42N2O6 — CID 59906970
tert-butyl (2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-[3-(3-hydroxypropoxy)propoxy]pyrrolidine-2-carboxylate (PubChem CID 59906970) has the molecular formula C23H42N2O6 and a molecular weight of 442.60 g/mol. Its IUPAC name is tert-butyl (2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-[3-(3-hydroxypropoxy)propoxy]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-[3-(3-hydroxypropoxy)propoxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59906970 |
| Molecular Formula | C23H42N2O6 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | tert-butyl (2S,4R)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-[3-(3-hydroxypropoxy)propoxy]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](OCCCOCCCO)CN1C(=O)[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C23H42N2O6/c1-23(2,3)31-22(28)19-15-18(30-14-8-13-29-12-7-11-26)16-25(19)21(27)20(24)17-9-5-4-6-10-17/h17-20,26H,4-16,24H2,1-3H3/t18-,19+,20+/m1/s1 |
| InChIKey | PHQKUNWZPKXCDW-AABGKKOBSA-N |
| XLogP | 2.01 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|