C20H39FN2 — CID 176629808
1-tert-butyl-4-[(4-tert-butyl-2-methylpiperidin-1-yl)methyl]-4-fluoropiperidine (PubChem CID 176629808) has the molecular formula C20H39FN2 and a molecular weight of 326.54 g/mol. Its IUPAC name is 1-tert-butyl-4-[(4-tert-butyl-2-methylpiperidin-1-yl)methyl]-4-fluoropiperidine.
| Compound Name | 1-tert-butyl-4-[(4-tert-butyl-2-methylpiperidin-1-yl)methyl]-4-fluoropiperidine |
|---|---|
| PubChem CID | 176629808 |
| Molecular Formula | C20H39FN2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.31 |
| IUPAC Name | 1-tert-butyl-4-[(4-tert-butyl-2-methylpiperidin-1-yl)methyl]-4-fluoropiperidine |
| SMILES | CC1CC(C(C)(C)C)CCN1CC1(F)CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H39FN2/c1-16-14-17(18(2,3)4)8-11-22(16)15-20(21)9-12-23(13-10-20)19(5,6)7/h16-17H,8-15H2,1-7H3 |
| InChIKey | LWARVBQKPFSKNA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |