C19H22NO2P — CID 176630237
3-[2-bis(4-methylphenyl)phosphanylethyl]-1,3-oxazolidin-2-one (PubChem CID 176630237) has the molecular formula C19H22NO2P and a molecular weight of 327.36 g/mol. Its IUPAC name is 3-[2-bis(4-methylphenyl)phosphanylethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-bis(4-methylphenyl)phosphanylethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 176630237 |
| Molecular Formula | C19H22NO2P |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-[2-bis(4-methylphenyl)phosphanylethyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(P(CCN2CCOC2=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H22NO2P/c1-15-3-7-17(8-4-15)23(18-9-5-16(2)6-10-18)14-12-20-11-13-22-19(20)21/h3-10H,11-14H2,1-2H3 |
| InChIKey | OEPNNEZABWENAX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|