C20H27NO3 — CID 10758741
tert-butyl (4R)-2,2-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 10758741) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10758741 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(1E,3E)-4-phenylbuta-1,3-dienyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C/C=C/c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C20H27NO3/c1-19(2,3)24-18(22)21-17(15-23-20(21,4)5)14-10-9-13-16-11-7-6-8-12-16/h6-14,17H,15H2,1-5H3/b13-9+,14-10+/t17-/m1/s1 |
| InChIKey | KCVWMHXDRKXEKZ-PQLSIUDJSA-N |
| XLogP | 4.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|