C23H44N2 — CID 176634043
8-tert-butyl-5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-5-azaspiro[3.5]nonane (PubChem CID 176634043) has the molecular formula C23H44N2 and a molecular weight of 348.62 g/mol. Its IUPAC name is 8-tert-butyl-5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-5-azaspiro[3.5]nonane.
| Compound Name | 8-tert-butyl-5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-5-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 176634043 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | 8-tert-butyl-5-[2-(1-tert-butylpiperidin-4-yl)ethyl]-5-azaspiro[3.5]nonane |
| SMILES | CC(C)(C)C1CCN(CCC2CCN(C(C)(C)C)CC2)C2(CCC2)C1 |
| InChI | InChI=1S/C23H44N2/c1-21(2,3)20-11-17-25(23(18-20)12-7-13-23)16-10-19-8-14-24(15-9-19)22(4,5)6/h19-20H,7-18H2,1-6H3 |
| InChIKey | YBSCHTYCMDGPIE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |