C18H20F2O2 — CID 176636669
2-[(4-butan-2-ylphenoxy)-methoxymethyl]-1,3-difluorobenzene (PubChem CID 176636669) has the molecular formula C18H20F2O2 and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[(4-butan-2-ylphenoxy)-methoxymethyl]-1,3-difluorobenzene.
| Compound Name | 2-[(4-butan-2-ylphenoxy)-methoxymethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 176636669 |
| Molecular Formula | C18H20F2O2 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[(4-butan-2-ylphenoxy)-methoxymethyl]-1,3-difluorobenzene |
| SMILES | CCC(C)c1ccc(OC(OC)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C18H20F2O2/c1-4-12(2)13-8-10-14(11-9-13)22-18(21-3)17-15(19)6-5-7-16(17)20/h5-12,18H,4H2,1-3H3 |
| InChIKey | ZHVRPADHMKCWPB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|