C17H27N3O6 — CID 176641455
5-methyl-1-[(2R,3S,5R,6R)-3,4,6-trimethoxy-9-methyl-1-oxa-9-azaspiro[4.5]decan-2-yl]pyrimidine-2,4-dione (PubChem CID 176641455) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is 5-methyl-1-[(2R,3S,5R,6R)-3,4,6-trimethoxy-9-methyl-1-oxa-9-azaspiro[4.5]decan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,3S,5R,6R)-3,4,6-trimethoxy-9-methyl-1-oxa-9-azaspiro[4.5]decan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 176641455 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 5-methyl-1-[(2R,3S,5R,6R)-3,4,6-trimethoxy-9-methyl-1-oxa-9-azaspiro[4.5]decan-2-yl]pyrimidine-2,4-dione |
| SMILES | COC1[C@H](OC)[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@]12CN(C)CC[C@H]2OC |
| InChI | InChI=1S/C17H27N3O6/c1-10-8-20(16(22)18-14(10)21)15-12(24-4)13(25-5)17(26-15)9-19(2)7-6-11(17)23-3/h8,11-13,15H,6-7,9H2,1-5H3,(H,18,21,22)/t11-,12+,13?,15-,17-/m1/s1 |
| InChIKey | HZGAYKWSVQXSQY-OUEQPODYSA-N |
| XLogP | -0.51 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |